C44H76NO8P — CID 24778986
2,3-bis[[(8E,10E,12E)-octadeca-8,10,12-trienoyl]oxy]propyl 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 24778986) has the molecular formula C44H76NO8P and a molecular weight of 778.07 g/mol. Its IUPAC name is 2,3-bis[[(8E,10E,12E)-octadeca-8,10,12-trienoyl]oxy]propyl 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | 2,3-bis[[(8E,10E,12E)-octadeca-8,10,12-trienoyl]oxy]propyl 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 24778986 |
| Molecular Formula | C44H76NO8P |
| Molecular Weight | 778.07 g/mol |
| Exact Mass | 777.53 |
| IUPAC Name | 2,3-bis[[(8E,10E,12E)-octadeca-8,10,12-trienoyl]oxy]propyl 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCC/C=C/C=C/C=C/CCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCC/C=C/C=C/C=C/CCCCC |
| InChI | InChI=1S/C44H76NO8P/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-43(46)50-40-42(41-52-54(48,49)51-39-38-45(3,4)5)53-44(47)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h14-25,42H,6-13,26-41H2,1-5H3/b16-14+,17-15+,20-18+,21-19+,24-22+,25-23+ |
| InChIKey | URJIZGFTFFFBRT-HJVJJHIMSA-N |
| XLogP | 10.83 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.07 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|