C44H72NO8P — CID 24778998
2,3-bis[[(9Z,11Z,13Z,15Z)-octadeca-9,11,13,15-tetraenoyl]oxy]propyl 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 24778998) has the molecular formula C44H72NO8P and a molecular weight of 774.03 g/mol. Its IUPAC name is 2,3-bis[[(9Z,11Z,13Z,15Z)-octadeca-9,11,13,15-tetraenoyl]oxy]propyl 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | 2,3-bis[[(9Z,11Z,13Z,15Z)-octadeca-9,11,13,15-tetraenoyl]oxy]propyl 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 24778998 |
| Molecular Formula | C44H72NO8P |
| Molecular Weight | 774.03 g/mol |
| Exact Mass | 773.50 |
| IUPAC Name | 2,3-bis[[(9Z,11Z,13Z,15Z)-octadeca-9,11,13,15-tetraenoyl]oxy]propyl 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC/C=C\C=C/C=C\C=C/CCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCC/C=C\C=C/C=C\C=C/CC |
| InChI | InChI=1S/C44H72NO8P/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-43(46)50-40-42(41-52-54(48,49)51-39-38-45(3,4)5)53-44(47)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h8-23,42H,6-7,24-41H2,1-5H3/b10-8-,11-9-,14-12-,15-13-,18-16-,19-17-,22-20-,23-21- |
| InChIKey | DDKZSATYMHCURC-BKNKFZIGSA-N |
| XLogP | 10.38 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.03 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|