C16H18N2O4 — CID 2477905
(3R)-3-[2-(4-acetylpiperazin-1-yl)-2-oxoethyl]-3H-2-benzofuran-1-one (PubChem CID 2477905) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is (3R)-3-[2-(4-acetylpiperazin-1-yl)-2-oxoethyl]-3H-2-benzofuran-1-one.
| Compound Name | (3R)-3-[2-(4-acetylpiperazin-1-yl)-2-oxoethyl]-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 2477905 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (3R)-3-[2-(4-acetylpiperazin-1-yl)-2-oxoethyl]-3H-2-benzofuran-1-one |
| SMILES | CC(=O)N1CCN(C(=O)C[C@H]2OC(=O)c3ccccc32)CC1 |
| InChI | InChI=1S/C16H18N2O4/c1-11(19)17-6-8-18(9-7-17)15(20)10-14-12-4-2-3-5-13(12)16(21)22-14/h2-5,14H,6-10H2,1H3/t14-/m1/s1 |
| InChIKey | BNAUHUMLQUDITK-CQSZACIVSA-N |
| XLogP | 0.98 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |