C6H12F2O10P2 — CID 24779755
2,2-difluoro-3-hydroxy-5-[hydroxy(phosphonooxy)phosphoryl]oxy-3-methylpentanoic acid (PubChem CID 24779755) has the molecular formula C6H12F2O10P2 and a molecular weight of 344.10 g/mol. Its IUPAC name is 2,2-difluoro-3-hydroxy-5-[hydroxy(phosphonooxy)phosphoryl]oxy-3-methylpentanoic acid.
| Compound Name | 2,2-difluoro-3-hydroxy-5-[hydroxy(phosphonooxy)phosphoryl]oxy-3-methylpentanoic acid |
|---|---|
| PubChem CID | 24779755 |
| Molecular Formula | C6H12F2O10P2 |
| Molecular Weight | 344.10 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | 2,2-difluoro-3-hydroxy-5-[hydroxy(phosphonooxy)phosphoryl]oxy-3-methylpentanoic acid |
| SMILES | CC(O)(CCOP(=O)(O)OP(=O)(O)O)C(F)(F)C(=O)O |
| InChI | InChI=1S/C6H12F2O10P2/c1-5(11,6(7,8)4(9)10)2-3-17-20(15,16)18-19(12,13)14/h11H,2-3H2,1H3,(H,9,10)(H,15,16)(H2,12,13,14) |
| InChIKey | TYAGFMDNISQMRJ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 170.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.10 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|