C17H12N2O3 — CID 24779966
14-hydroxy-9,19-diazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),2(6),7(11),13(18),14,16-hexaene-8,10-dione (PubChem CID 24779966) has the molecular formula C17H12N2O3 and a molecular weight of 292.29 g/mol. Its IUPAC name is 14-hydroxy-9,19-diazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),2(6),7(11),13(18),14,16-hexaene-8,10-dione.
| Compound Name | 14-hydroxy-9,19-diazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),2(6),7(11),13(18),14,16-hexaene-8,10-dione |
|---|---|
| PubChem CID | 24779966 |
| Molecular Formula | C17H12N2O3 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 14-hydroxy-9,19-diazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),2(6),7(11),13(18),14,16-hexaene-8,10-dione |
| SMILES | O=C1NC(=O)c2c1c1c(c3[nH]c4cccc(O)c4c23)CCC1 |
| InChI | InChI=1S/C17H12N2O3/c20-10-6-2-5-9-12(10)13-14-11(16(21)19-17(14)22)7-3-1-4-8(7)15(13)18-9/h2,5-6,18,20H,1,3-4H2,(H,19,21,22) |
| InChIKey | JBDCMDRXNLEZPE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|