C29H28Cl2FN3O3 — CID 24780079
3-[[4-[[1-(2,6-dichlorophenyl)-4-propan-2-ylpyrazol-5-yl]methoxy]-N,2-dimethylanilino]methyl]-4-fluorobenzoic acid (PubChem CID 24780079) has the molecular formula C29H28Cl2FN3O3 and a molecular weight of 556.47 g/mol. Its IUPAC name is 3-[[4-[[1-(2,6-dichlorophenyl)-4-propan-2-ylpyrazol-5-yl]methoxy]-N,2-dimethylanilino]methyl]-4-fluorobenzoic acid.
| Compound Name | 3-[[4-[[1-(2,6-dichlorophenyl)-4-propan-2-ylpyrazol-5-yl]methoxy]-N,2-dimethylanilino]methyl]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 24780079 |
| Molecular Formula | C29H28Cl2FN3O3 |
| Molecular Weight | 556.47 g/mol |
| Exact Mass | 555.15 |
| IUPAC Name | 3-[[4-[[1-(2,6-dichlorophenyl)-4-propan-2-ylpyrazol-5-yl]methoxy]-N,2-dimethylanilino]methyl]-4-fluorobenzoic acid |
| SMILES | Cc1cc(OCc2c(C(C)C)cnn2-c2c(Cl)cccc2Cl)ccc1N(C)Cc1cc(C(=O)O)ccc1F |
| InChI | InChI=1S/C29H28Cl2FN3O3/c1-17(2)22-14-33-35(28-23(30)6-5-7-24(28)31)27(22)16-38-21-9-11-26(18(3)12-21)34(4)15-20-13-19(29(36)37)8-10-25(20)32/h5-14,17H,15-16H2,1-4H3,(H,36,37) |
| InChIKey | SZUCNHMTJUGQAM-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.47 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|