C27H28FN3O2 — CID 24780165
(3E,6S,9aR)-6-(2-fluorophenyl)-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-2,6,7,8,9,9a-hexahydro-1H-quinolizin-4-one (PubChem CID 24780165) has the molecular formula C27H28FN3O2 and a molecular weight of 445.54 g/mol. Its IUPAC name is (3E,6S,9aR)-6-(2-fluorophenyl)-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-2,6,7,8,9,9a-hexahydro-1H-quinolizin-4-one.
| Compound Name | (3E,6S,9aR)-6-(2-fluorophenyl)-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-2,6,7,8,9,9a-hexahydro-1H-quinolizin-4-one |
|---|---|
| PubChem CID | 24780165 |
| Molecular Formula | C27H28FN3O2 |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | (3E,6S,9aR)-6-(2-fluorophenyl)-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-2,6,7,8,9,9a-hexahydro-1H-quinolizin-4-one |
| SMILES | COc1cc(/C=C2\CC[C@H]3CCC[C@@H](c4ccccc4F)N3C2=O)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C27H28FN3O2/c1-18-16-30(17-29-18)25-13-10-19(15-26(25)33-2)14-20-11-12-21-6-5-9-24(31(21)27(20)32)22-7-3-4-8-23(22)28/h3-4,7-8,10,13-17,21,24H,5-6,9,11-12H2,1-2H3/b20-14+/t21-,24+/m1/s1 |
| InChIKey | IKNILOGNMQUCBT-YAMOPBLLSA-N |
| XLogP | 5.63 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|