C28H30FN3O3 — CID 24780166
(3E,6S,8R,9aR)-6-(4-fluorophenyl)-8-hydroxy-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-8-methyl-1,2,6,7,9,9a-hexahydroquinolizin-4-one (PubChem CID 24780166) has the molecular formula C28H30FN3O3 and a molecular weight of 475.56 g/mol. Its IUPAC name is (3E,6S,8R,9aR)-6-(4-fluorophenyl)-8-hydroxy-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-8-methyl-1,2,6,7,9,9a-hexahydroquinolizin-4-one.
| Compound Name | (3E,6S,8R,9aR)-6-(4-fluorophenyl)-8-hydroxy-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-8-methyl-1,2,6,7,9,9a-hexahydroquinolizin-4-one |
|---|---|
| PubChem CID | 24780166 |
| Molecular Formula | C28H30FN3O3 |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | (3E,6S,8R,9aR)-6-(4-fluorophenyl)-8-hydroxy-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-8-methyl-1,2,6,7,9,9a-hexahydroquinolizin-4-one |
| SMILES | COc1cc(/C=C2\CC[C@@H]3C[C@@](C)(O)C[C@@H](c4ccc(F)cc4)N3C2=O)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C28H30FN3O3/c1-18-16-31(17-30-18)24-11-4-19(13-26(24)35-3)12-21-7-10-23-14-28(2,34)15-25(32(23)27(21)33)20-5-8-22(29)9-6-20/h4-6,8-9,11-13,16-17,23,25,34H,7,10,14-15H2,1-3H3/b21-12+/t23-,25+,28-/m1/s1 |
| InChIKey | WXDHHCXAXZUEAH-PMAVLLQSSA-N |
| XLogP | 4.99 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|