About 3-cyano-N-[(2,6-difluorophenyl)methyl]-N-(3-oxo-1H-2-benzofuran-5-yl)benzenesulfonamide
3-cyano-N-[(2,6-difluorophenyl)methyl]-N-(3-oxo-1H-2-benzofuran-5-yl)benzenesulfonamide (PubChem CID 24780296) has the molecular formula C22H14F2N2O4S
and a molecular weight of 440.43 g/mol. Its IUPAC name is 3-cyano-N-[(2,6-difluorophenyl)methyl]-N-(3-oxo-1H-2-benzofuran-5-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 3-cyano-N-[(2,6-difluorophenyl)methyl]-N-(3-oxo-1H-2-benzofuran-5-yl)benzenesulfonamide |
| PubChem CID | 24780296 |
| Molecular Formula | C22H14F2N2O4S |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | 3-cyano-N-[(2,6-difluorophenyl)methyl]-N-(3-oxo-1H-2-benzofuran-5-yl)benzenesulfonamide |
| SMILES | N#Cc1cccc(S(=O)(=O)N(Cc2c(F)cccc2F)c2ccc3c(c2)C(=O)OC3)c1 |
| InChI | InChI=1S/C22H14F2N2O4S/c23-20-5-2-6-21(24)19(20)12-26(16-8-7-15-13-30-22(27)18(15)10-16)31(28,29)17-4-1-3-14(9-17)11-25/h1-10H,12-13H2 |
| InChIKey | NPZQQKWOCSYTOW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-cyano-N-[(2,6-difluorophenyl)methyl]-N-(3-oxo-1H-2-benzofuran-5-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyano-N-[(2,6-difluorophenyl)methyl]-N-(3-oxo-1H-2-benzofuran-5-yl)benzenesulfonamide?
The IUPAC name of 3-cyano-N-[(2,6-difluorophenyl)methyl]-N-(3-oxo-1H-2-benzofuran-5-yl)benzenesulfonamide (CID 24780296) is 3-cyano-N-[(2,6-difluorophenyl)methyl]-N-(3-oxo-1H-2-benzofuran-5-yl)benzenesulfonamide.
What is the SMILES notation for 3-cyano-N-[(2,6-difluorophenyl)methyl]-N-(3-oxo-1H-2-benzofuran-5-yl)benzenesulfonamide?
The canonical SMILES for 3-cyano-N-[(2,6-difluorophenyl)methyl]-N-(3-oxo-1H-2-benzofuran-5-yl)benzenesulfonamide is N#Cc1cccc(S(=O)(=O)N(Cc2c(F)cccc2F)c2ccc3c(c2)C(=O)OC3)c1.
What is the InChIKey of 3-cyano-N-[(2,6-difluorophenyl)methyl]-N-(3-oxo-1H-2-benzofuran-5-yl)benzenesulfonamide?
The InChIKey is NPZQQKWOCSYTOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14F2N2O4S/c23-20-5-2-6-21(24)19(20)12-26(16-8-7-15-13-30-22(27)18(15)10-16)31(28,29)17-4-1-3-14(9-17)11-25/h1-10H,12-13H2.
What are the key properties of 3-cyano-N-[(2,6-difluorophenyl)methyl]-N-(3-oxo-1H-2-benzofuran-5-yl)benzenesulfonamide?
3-cyano-N-[(2,6-difluorophenyl)methyl]-N-(3-oxo-1H-2-benzofuran-5-yl)benzenesulfonamide has a molecular weight of 440.43 g/mol, XLogP of 3.90, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyano-N-[(2,6-difluorophenyl)methyl]-N-(3-oxo-1H-2-benzofuran-5-yl)benzenesulfonamide is sourced from PubChem (CID 24780296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).