C26H24F3N3O2 — CID 24780587
(3S,6E,8aS)-6-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3-(2,4,5-trifluorophenyl)-1,2,3,7,8,8a-hexahydroindolizin-5-one (PubChem CID 24780587) has the molecular formula C26H24F3N3O2 and a molecular weight of 467.49 g/mol. Its IUPAC name is (3S,6E,8aS)-6-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3-(2,4,5-trifluorophenyl)-1,2,3,7,8,8a-hexahydroindolizin-5-one.
| Compound Name | (3S,6E,8aS)-6-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3-(2,4,5-trifluorophenyl)-1,2,3,7,8,8a-hexahydroindolizin-5-one |
|---|---|
| PubChem CID | 24780587 |
| Molecular Formula | C26H24F3N3O2 |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | (3S,6E,8aS)-6-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3-(2,4,5-trifluorophenyl)-1,2,3,7,8,8a-hexahydroindolizin-5-one |
| SMILES | COc1cc(/C=C2\CC[C@H]3CC[C@@H](c4cc(F)c(F)cc4F)N3C2=O)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C26H24F3N3O2/c1-15-13-31(14-30-15)24-7-3-16(10-25(24)34-2)9-17-4-5-18-6-8-23(32(18)26(17)33)19-11-21(28)22(29)12-20(19)27/h3,7,9-14,18,23H,4-6,8H2,1-2H3/b17-9+/t18-,23-/m0/s1 |
| InChIKey | TVCYEIGOPDWGRQ-VAOYNJDCSA-N |
| XLogP | 5.52 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|