C25H24F2N4O2 — CID 24780591
(3S,6E,8aS)-3-(2,6-difluoro-3-pyridinyl)-6-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1,2,3,7,8,8a-hexahydroindolizin-5-one (PubChem CID 24780591) has the molecular formula C25H24F2N4O2 and a molecular weight of 450.49 g/mol. Its IUPAC name is (3S,6E,8aS)-3-(2,6-difluoro-3-pyridinyl)-6-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1,2,3,7,8,8a-hexahydroindolizin-5-one.
| Compound Name | (3S,6E,8aS)-3-(2,6-difluoro-3-pyridinyl)-6-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1,2,3,7,8,8a-hexahydroindolizin-5-one |
|---|---|
| PubChem CID | 24780591 |
| Molecular Formula | C25H24F2N4O2 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | (3S,6E,8aS)-3-(2,6-difluoro-3-pyridinyl)-6-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1,2,3,7,8,8a-hexahydroindolizin-5-one |
| SMILES | COc1cc(/C=C2\CC[C@H]3CC[C@@H](c4ccc(F)nc4F)N3C2=O)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C25H24F2N4O2/c1-15-13-30(14-28-15)21-8-3-16(12-22(21)33-2)11-17-4-5-18-6-9-20(31(18)25(17)32)19-7-10-23(26)29-24(19)27/h3,7-8,10-14,18,20H,4-6,9H2,1-2H3/b17-11+/t18-,20-/m0/s1 |
| InChIKey | AUOAKAXUSQJSFI-WMSAKZMXSA-N |
| XLogP | 4.77 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|