About 3-[3,5-dibromo-4-[[2-(4-chlorophenyl)-3-ethyl-1H-indol-5-yl]oxy]phenyl]propanoic acid
3-[3,5-dibromo-4-[[2-(4-chlorophenyl)-3-ethyl-1H-indol-5-yl]oxy]phenyl]propanoic acid (PubChem CID 24780753) has the molecular formula C25H20Br2ClNO3
and a molecular weight of 577.70 g/mol. Its IUPAC name is 3-[3,5-dibromo-4-[[2-(4-chlorophenyl)-3-ethyl-1H-indol-5-yl]oxy]phenyl]propanoic acid.
Molecular Properties
| Compound Name | 3-[3,5-dibromo-4-[[2-(4-chlorophenyl)-3-ethyl-1H-indol-5-yl]oxy]phenyl]propanoic acid |
| PubChem CID | 24780753 |
| Molecular Formula | C25H20Br2ClNO3 |
| Molecular Weight | 577.70 g/mol |
| Exact Mass | 574.95 |
| IUPAC Name | 3-[3,5-dibromo-4-[[2-(4-chlorophenyl)-3-ethyl-1H-indol-5-yl]oxy]phenyl]propanoic acid |
| SMILES | CCc1c(-c2ccc(Cl)cc2)[nH]c2ccc(Oc3c(Br)cc(CCC(=O)O)cc3Br)cc12 |
| InChI | InChI=1S/C25H20Br2ClNO3/c1-2-18-19-13-17(8-9-22(19)29-24(18)15-4-6-16(28)7-5-15)32-25-20(26)11-14(12-21(25)27)3-10-23(30)31/h4-9,11-13,29H,2-3,10H2,1H3,(H,30,31) |
| InChIKey | ICHYHWINXAWHAF-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 577.70 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[3,5-dibromo-4-[[2-(4-chlorophenyl)-3-ethyl-1H-indol-5-yl]oxy]phenyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,5-dibromo-4-[[2-(4-chlorophenyl)-3-ethyl-1H-indol-5-yl]oxy]phenyl]propanoic acid?
The IUPAC name of 3-[3,5-dibromo-4-[[2-(4-chlorophenyl)-3-ethyl-1H-indol-5-yl]oxy]phenyl]propanoic acid (CID 24780753) is 3-[3,5-dibromo-4-[[2-(4-chlorophenyl)-3-ethyl-1H-indol-5-yl]oxy]phenyl]propanoic acid.
What is the SMILES notation for 3-[3,5-dibromo-4-[[2-(4-chlorophenyl)-3-ethyl-1H-indol-5-yl]oxy]phenyl]propanoic acid?
The canonical SMILES for 3-[3,5-dibromo-4-[[2-(4-chlorophenyl)-3-ethyl-1H-indol-5-yl]oxy]phenyl]propanoic acid is CCc1c(-c2ccc(Cl)cc2)[nH]c2ccc(Oc3c(Br)cc(CCC(=O)O)cc3Br)cc12.
What is the InChIKey of 3-[3,5-dibromo-4-[[2-(4-chlorophenyl)-3-ethyl-1H-indol-5-yl]oxy]phenyl]propanoic acid?
The InChIKey is ICHYHWINXAWHAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20Br2ClNO3/c1-2-18-19-13-17(8-9-22(19)29-24(18)15-4-6-16(28)7-5-15)32-25-20(26)11-14(12-21(25)27)3-10-23(30)31/h4-9,11-13,29H,2-3,10H2,1H3,(H,30,31).
What are the key properties of 3-[3,5-dibromo-4-[[2-(4-chlorophenyl)-3-ethyl-1H-indol-5-yl]oxy]phenyl]propanoic acid?
3-[3,5-dibromo-4-[[2-(4-chlorophenyl)-3-ethyl-1H-indol-5-yl]oxy]phenyl]propanoic acid has a molecular weight of 577.70 g/mol, XLogP of 8.39, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,5-dibromo-4-[[2-(4-chlorophenyl)-3-ethyl-1H-indol-5-yl]oxy]phenyl]propanoic acid is sourced from PubChem (CID 24780753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).