C27H25F4N3O2 — CID 24781181
(3E,6S,8R,9aR)-8-fluoro-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6-(3,4,5-trifluorophenyl)-2,6,7,8,9,9a-hexahydro-1H-quinolizin-4-one (PubChem CID 24781181) has the molecular formula C27H25F4N3O2 and a molecular weight of 499.51 g/mol. Its IUPAC name is (3E,6S,8R,9aR)-8-fluoro-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6-(3,4,5-trifluorophenyl)-2,6,7,8,9,9a-hexahydro-1H-quinolizin-4-one.
| Compound Name | (3E,6S,8R,9aR)-8-fluoro-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6-(3,4,5-trifluorophenyl)-2,6,7,8,9,9a-hexahydro-1H-quinolizin-4-one |
|---|---|
| PubChem CID | 24781181 |
| Molecular Formula | C27H25F4N3O2 |
| Molecular Weight | 499.51 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | (3E,6S,8R,9aR)-8-fluoro-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6-(3,4,5-trifluorophenyl)-2,6,7,8,9,9a-hexahydro-1H-quinolizin-4-one |
| SMILES | COc1cc(/C=C2\CC[C@@H]3C[C@@H](F)C[C@@H](c4cc(F)c(F)c(F)c4)N3C2=O)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C27H25F4N3O2/c1-15-13-33(14-32-15)23-6-3-16(8-25(23)36-2)7-17-4-5-20-11-19(28)12-24(34(20)27(17)35)18-9-21(29)26(31)22(30)10-18/h3,6-10,13-14,19-20,24H,4-5,11-12H2,1-2H3/b17-7+/t19-,20-,24+/m1/s1 |
| InChIKey | TXBGUYBJYHHLFK-HPWGVMLKSA-N |
| XLogP | 5.85 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.51 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|