About 4-[4-[(1S,2R)-2-[2-(azepan-1-yl)ethyl]cyclopropyl]phenyl]benzonitrile
4-[4-[(1S,2R)-2-[2-(azepan-1-yl)ethyl]cyclopropyl]phenyl]benzonitrile (PubChem CID 24781278) has the molecular formula C24H28N2
and a molecular weight of 344.50 g/mol. Its IUPAC name is 4-[4-[(1S,2R)-2-[2-(azepan-1-yl)ethyl]cyclopropyl]phenyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[4-[(1S,2R)-2-[2-(azepan-1-yl)ethyl]cyclopropyl]phenyl]benzonitrile |
| PubChem CID | 24781278 |
| Molecular Formula | C24H28N2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | 4-[4-[(1S,2R)-2-[2-(azepan-1-yl)ethyl]cyclopropyl]phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc([C@H]3C[C@@H]3CCN3CCCCCC3)cc2)cc1 |
| InChI | InChI=1S/C24H28N2/c25-18-19-5-7-20(8-6-19)21-9-11-22(12-10-21)24-17-23(24)13-16-26-14-3-1-2-4-15-26/h5-12,23-24H,1-4,13-17H2/t23-,24+/m0/s1 |
| InChIKey | MKSCUCOKTBDRRN-BJKOFHAPSA-N |
| XLogP | 5.59 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[4-[(1S,2R)-2-[2-(azepan-1-yl)ethyl]cyclopropyl]phenyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[(1S,2R)-2-[2-(azepan-1-yl)ethyl]cyclopropyl]phenyl]benzonitrile?
The IUPAC name of 4-[4-[(1S,2R)-2-[2-(azepan-1-yl)ethyl]cyclopropyl]phenyl]benzonitrile (CID 24781278) is 4-[4-[(1S,2R)-2-[2-(azepan-1-yl)ethyl]cyclopropyl]phenyl]benzonitrile.
What is the SMILES notation for 4-[4-[(1S,2R)-2-[2-(azepan-1-yl)ethyl]cyclopropyl]phenyl]benzonitrile?
The canonical SMILES for 4-[4-[(1S,2R)-2-[2-(azepan-1-yl)ethyl]cyclopropyl]phenyl]benzonitrile is N#Cc1ccc(-c2ccc([C@H]3C[C@@H]3CCN3CCCCCC3)cc2)cc1.
What is the InChIKey of 4-[4-[(1S,2R)-2-[2-(azepan-1-yl)ethyl]cyclopropyl]phenyl]benzonitrile?
The InChIKey is MKSCUCOKTBDRRN-BJKOFHAPSA-N. The full InChI is InChI=1S/C24H28N2/c25-18-19-5-7-20(8-6-19)21-9-11-22(12-10-21)24-17-23(24)13-16-26-14-3-1-2-4-15-26/h5-12,23-24H,1-4,13-17H2/t23-,24+/m0/s1.
What are the key properties of 4-[4-[(1S,2R)-2-[2-(azepan-1-yl)ethyl]cyclopropyl]phenyl]benzonitrile?
4-[4-[(1S,2R)-2-[2-(azepan-1-yl)ethyl]cyclopropyl]phenyl]benzonitrile has a molecular weight of 344.50 g/mol, XLogP of 5.59, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(1S,2R)-2-[2-(azepan-1-yl)ethyl]cyclopropyl]phenyl]benzonitrile is sourced from PubChem (CID 24781278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).