C27H26F3N3O3 — CID 24781334
(3E,6R,7S,9aR)-7-hydroxy-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6-(3,4,5-trifluorophenyl)-2,6,7,8,9,9a-hexahydro-1H-quinolizin-4-one (PubChem CID 24781334) has the molecular formula C27H26F3N3O3 and a molecular weight of 497.52 g/mol. Its IUPAC name is (3E,6R,7S,9aR)-7-hydroxy-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6-(3,4,5-trifluorophenyl)-2,6,7,8,9,9a-hexahydro-1H-quinolizin-4-one.
| Compound Name | (3E,6R,7S,9aR)-7-hydroxy-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6-(3,4,5-trifluorophenyl)-2,6,7,8,9,9a-hexahydro-1H-quinolizin-4-one |
|---|---|
| PubChem CID | 24781334 |
| Molecular Formula | C27H26F3N3O3 |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | (3E,6R,7S,9aR)-7-hydroxy-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6-(3,4,5-trifluorophenyl)-2,6,7,8,9,9a-hexahydro-1H-quinolizin-4-one |
| SMILES | COc1cc(/C=C2\CC[C@@H]3CC[C@H](O)[C@@H](c4cc(F)c(F)c(F)c4)N3C2=O)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C27H26F3N3O3/c1-15-13-32(14-31-15)22-7-3-16(10-24(22)36-2)9-17-4-5-19-6-8-23(34)26(33(19)27(17)35)18-11-20(28)25(30)21(29)12-18/h3,7,9-14,19,23,26,34H,4-6,8H2,1-2H3/b17-9+/t19-,23+,26-/m1/s1 |
| InChIKey | UJUXEDADWGTPCA-IOMWBJKESA-N |
| XLogP | 4.88 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|