C24H39NO2 — CID 24781895
(1R,3S)-1'-decyl-3-methoxyspiro[3,4-dihydroisochromene-1,3'-piperidine] (PubChem CID 24781895) has the molecular formula C24H39NO2 and a molecular weight of 373.58 g/mol. Its IUPAC name is (1R,3S)-1'-decyl-3-methoxyspiro[3,4-dihydroisochromene-1,3'-piperidine].
| Compound Name | (1R,3S)-1'-decyl-3-methoxyspiro[3,4-dihydroisochromene-1,3'-piperidine] |
|---|---|
| PubChem CID | 24781895 |
| Molecular Formula | C24H39NO2 |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 373.30 |
| IUPAC Name | (1R,3S)-1'-decyl-3-methoxyspiro[3,4-dihydroisochromene-1,3'-piperidine] |
| SMILES | CCCCCCCCCCN1CCC[C@@]2(C1)O[C@H](OC)Cc1ccccc12 |
| InChI | InChI=1S/C24H39NO2/c1-3-4-5-6-7-8-9-12-17-25-18-13-16-24(20-25)22-15-11-10-14-21(22)19-23(26-2)27-24/h10-11,14-15,23H,3-9,12-13,16-20H2,1-2H3/t23-,24-/m0/s1 |
| InChIKey | RCGSRJRQRQQHKG-ZEQRLZLVSA-N |
| XLogP | 5.66 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|