C11H16N2O2 — CID 24782
Benzoic acid, 4-amino-, 2-(dimethylamino)ethyl ester (PubChem CID 24782) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 4-aminobenzoate.
| Compound Name | Benzoic acid, 4-amino-, 2-(dimethylamino)ethyl ester |
|---|---|
| PubChem CID | 24782 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 2-(dimethylamino)ethyl 4-aminobenzoate |
| SMILES | CN(C)CCOC(=O)C1=CC=C(C=C1)N |
| InChI | InChI=1S/C11H16N2O2/c1-13(2)7-8-15-11(14)9-3-5-10(12)6-4-9/h3-6H,7-8,12H2,1-2H3 |
| InChIKey | MXBCQLLLJGRMJI-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 55.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | 199 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|