About N-[(2R,3R)-2-[4-(4-fluorophenyl)phenyl]oxolan-3-yl]propane-2-sulfonamide
N-[(2R,3R)-2-[4-(4-fluorophenyl)phenyl]oxolan-3-yl]propane-2-sulfonamide (PubChem CID 24782006) has the molecular formula C19H22FNO3S
and a molecular weight of 363.45 g/mol. Its IUPAC name is N-[(2R,3R)-2-[4-(4-fluorophenyl)phenyl]oxolan-3-yl]propane-2-sulfonamide.
Molecular Properties
| Compound Name | N-[(2R,3R)-2-[4-(4-fluorophenyl)phenyl]oxolan-3-yl]propane-2-sulfonamide |
| PubChem CID | 24782006 |
| Molecular Formula | C19H22FNO3S |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | N-[(2R,3R)-2-[4-(4-fluorophenyl)phenyl]oxolan-3-yl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)N[C@@H]1CCO[C@@H]1c1ccc(-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H22FNO3S/c1-13(2)25(22,23)21-18-11-12-24-19(18)16-5-3-14(4-6-16)15-7-9-17(20)10-8-15/h3-10,13,18-19,21H,11-12H2,1-2H3/t18-,19-/m1/s1 |
| InChIKey | CTQFGWIWSFSWNT-RTBURBONSA-N |
| XLogP | 3.65 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2R,3R)-2-[4-(4-fluorophenyl)phenyl]oxolan-3-yl]propane-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R,3R)-2-[4-(4-fluorophenyl)phenyl]oxolan-3-yl]propane-2-sulfonamide?
The IUPAC name of N-[(2R,3R)-2-[4-(4-fluorophenyl)phenyl]oxolan-3-yl]propane-2-sulfonamide (CID 24782006) is N-[(2R,3R)-2-[4-(4-fluorophenyl)phenyl]oxolan-3-yl]propane-2-sulfonamide.
What is the SMILES notation for N-[(2R,3R)-2-[4-(4-fluorophenyl)phenyl]oxolan-3-yl]propane-2-sulfonamide?
The canonical SMILES for N-[(2R,3R)-2-[4-(4-fluorophenyl)phenyl]oxolan-3-yl]propane-2-sulfonamide is CC(C)S(=O)(=O)N[C@@H]1CCO[C@@H]1c1ccc(-c2ccc(F)cc2)cc1.
What is the InChIKey of N-[(2R,3R)-2-[4-(4-fluorophenyl)phenyl]oxolan-3-yl]propane-2-sulfonamide?
The InChIKey is CTQFGWIWSFSWNT-RTBURBONSA-N. The full InChI is InChI=1S/C19H22FNO3S/c1-13(2)25(22,23)21-18-11-12-24-19(18)16-5-3-14(4-6-16)15-7-9-17(20)10-8-15/h3-10,13,18-19,21H,11-12H2,1-2H3/t18-,19-/m1/s1.
What are the key properties of N-[(2R,3R)-2-[4-(4-fluorophenyl)phenyl]oxolan-3-yl]propane-2-sulfonamide?
N-[(2R,3R)-2-[4-(4-fluorophenyl)phenyl]oxolan-3-yl]propane-2-sulfonamide has a molecular weight of 363.45 g/mol, XLogP of 3.65, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R,3R)-2-[4-(4-fluorophenyl)phenyl]oxolan-3-yl]propane-2-sulfonamide is sourced from PubChem (CID 24782006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).