C26H26ClF3N2O2 — CID 24782154
2-chloro-5-methoxy-4-[3-[(4-phenylpiperidin-4-yl)methoxymethyl]-5-(trifluoromethyl)phenyl]pyridine (PubChem CID 24782154) has the molecular formula C26H26ClF3N2O2 and a molecular weight of 490.95 g/mol. Its IUPAC name is 2-chloro-5-methoxy-4-[3-[(4-phenylpiperidin-4-yl)methoxymethyl]-5-(trifluoromethyl)phenyl]pyridine.
| Compound Name | 2-chloro-5-methoxy-4-[3-[(4-phenylpiperidin-4-yl)methoxymethyl]-5-(trifluoromethyl)phenyl]pyridine |
|---|---|
| PubChem CID | 24782154 |
| Molecular Formula | C26H26ClF3N2O2 |
| Molecular Weight | 490.95 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | 2-chloro-5-methoxy-4-[3-[(4-phenylpiperidin-4-yl)methoxymethyl]-5-(trifluoromethyl)phenyl]pyridine |
| SMILES | COc1cnc(Cl)cc1-c1cc(COCC2(c3ccccc3)CCNCC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H26ClF3N2O2/c1-33-23-15-32-24(27)14-22(23)19-11-18(12-21(13-19)26(28,29)30)16-34-17-25(7-9-31-10-8-25)20-5-3-2-4-6-20/h2-6,11-15,31H,7-10,16-17H2,1H3 |
| InChIKey | FMEZWIMWEYGQRY-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.95 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|