C23H25F2N5O2 — CID 24782303
2-fluoro-N-[4-[5-[3-(4-fluoropiperidin-1-yl)propylamino]-1,3,4-oxadiazol-2-yl]phenyl]benzamide (PubChem CID 24782303) has the molecular formula C23H25F2N5O2 and a molecular weight of 441.48 g/mol. Its IUPAC name is 2-fluoro-N-[4-[5-[3-(4-fluoropiperidin-1-yl)propylamino]-1,3,4-oxadiazol-2-yl]phenyl]benzamide.
| Compound Name | 2-fluoro-N-[4-[5-[3-(4-fluoropiperidin-1-yl)propylamino]-1,3,4-oxadiazol-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 24782303 |
| Molecular Formula | C23H25F2N5O2 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | 2-fluoro-N-[4-[5-[3-(4-fluoropiperidin-1-yl)propylamino]-1,3,4-oxadiazol-2-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(-c2nnc(NCCCN3CCC(F)CC3)o2)cc1)c1ccccc1F |
| InChI | InChI=1S/C23H25F2N5O2/c24-17-10-14-30(15-11-17)13-3-12-26-23-29-28-22(32-23)16-6-8-18(9-7-16)27-21(31)19-4-1-2-5-20(19)25/h1-2,4-9,17H,3,10-15H2,(H,26,29)(H,27,31) |
| InChIKey | XLBYUGKZWZMFEL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 83.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|