C23H33N5O2 — CID 24782552
N-[4-[5-(3-piperidin-1-ylpropylamino)-1,3,4-oxadiazol-2-yl]phenyl]cyclohexanecarboxamide (PubChem CID 24782552) has the molecular formula C23H33N5O2 and a molecular weight of 411.55 g/mol. Its IUPAC name is N-[4-[5-(3-piperidin-1-ylpropylamino)-1,3,4-oxadiazol-2-yl]phenyl]cyclohexanecarboxamide.
| Compound Name | N-[4-[5-(3-piperidin-1-ylpropylamino)-1,3,4-oxadiazol-2-yl]phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 24782552 |
| Molecular Formula | C23H33N5O2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | N-[4-[5-(3-piperidin-1-ylpropylamino)-1,3,4-oxadiazol-2-yl]phenyl]cyclohexanecarboxamide |
| SMILES | O=C(Nc1ccc(-c2nnc(NCCCN3CCCCC3)o2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C23H33N5O2/c29-21(18-8-3-1-4-9-18)25-20-12-10-19(11-13-20)22-26-27-23(30-22)24-14-7-17-28-15-5-2-6-16-28/h10-13,18H,1-9,14-17H2,(H,24,27)(H,25,29) |
| InChIKey | PBRSZGRQNRVBHT-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 83.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|