C27H24F3N5O4 — CID 24782698
N-[2-[(1-phenyl-3-phenylmethoxypyrazole-4-carbonyl)amino]ethyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide (PubChem CID 24782698) has the molecular formula C27H24F3N5O4 and a molecular weight of 539.51 g/mol. Its IUPAC name is N-[2-[(1-phenyl-3-phenylmethoxypyrazole-4-carbonyl)amino]ethyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide.
| Compound Name | N-[2-[(1-phenyl-3-phenylmethoxypyrazole-4-carbonyl)amino]ethyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 24782698 |
| Molecular Formula | C27H24F3N5O4 |
| Molecular Weight | 539.51 g/mol |
| Exact Mass | 539.18 |
| IUPAC Name | N-[2-[(1-phenyl-3-phenylmethoxypyrazole-4-carbonyl)amino]ethyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
| SMILES | O=C(NCCNC(=O)c1cn(-c2ccccc2)nc1OCc1ccccc1)c1ccc(OCC(F)(F)F)nc1 |
| InChI | InChI=1S/C27H24F3N5O4/c28-27(29,30)18-39-23-12-11-20(15-33-23)24(36)31-13-14-32-25(37)22-16-35(21-9-5-2-6-10-21)34-26(22)38-17-19-7-3-1-4-8-19/h1-12,15-16H,13-14,17-18H2,(H,31,36)(H,32,37) |
| InChIKey | DFZKBAPOFGLJNH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|