C15H15BrClN5O4 — CID 24782843
2-amino-9-[(2-bromo-3,4,5-trimethoxyphenyl)methyl]-6-chloro-7H-purin-8-one (PubChem CID 24782843) has the molecular formula C15H15BrClN5O4 and a molecular weight of 444.67 g/mol. Its IUPAC name is 2-amino-9-[(2-bromo-3,4,5-trimethoxyphenyl)methyl]-6-chloro-7H-purin-8-one.
| Compound Name | 2-amino-9-[(2-bromo-3,4,5-trimethoxyphenyl)methyl]-6-chloro-7H-purin-8-one |
|---|---|
| PubChem CID | 24782843 |
| Molecular Formula | C15H15BrClN5O4 |
| Molecular Weight | 444.67 g/mol |
| Exact Mass | 443.00 |
| IUPAC Name | 2-amino-9-[(2-bromo-3,4,5-trimethoxyphenyl)methyl]-6-chloro-7H-purin-8-one |
| SMILES | COc1cc(Cn2c(=O)[nH]c3c(Cl)nc(N)nc32)c(Br)c(OC)c1OC |
| InChI | InChI=1S/C15H15BrClN5O4/c1-24-7-4-6(8(16)11(26-3)10(7)25-2)5-22-13-9(19-15(22)23)12(17)20-14(18)21-13/h4H,5H2,1-3H3,(H,19,23)(H2,18,20,21) |
| InChIKey | KGYFMMLCPMNIJL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.67 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |