C26H30N8O — CID 24783104
5-cyano-N-[4-(2-cyanoimino-1,3-dimethyl-1,3-diazinan-5-yl)-2-(4,4-dimethylcyclohexen-1-yl)phenyl]-1H-imidazole-2-carboxamide (PubChem CID 24783104) has the molecular formula C26H30N8O and a molecular weight of 470.58 g/mol. Its IUPAC name is 5-cyano-N-[4-(2-cyanoimino-1,3-dimethyl-1,3-diazinan-5-yl)-2-(4,4-dimethylcyclohexen-1-yl)phenyl]-1H-imidazole-2-carboxamide.
| Compound Name | 5-cyano-N-[4-(2-cyanoimino-1,3-dimethyl-1,3-diazinan-5-yl)-2-(4,4-dimethylcyclohexen-1-yl)phenyl]-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 24783104 |
| Molecular Formula | C26H30N8O |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 5-cyano-N-[4-(2-cyanoimino-1,3-dimethyl-1,3-diazinan-5-yl)-2-(4,4-dimethylcyclohexen-1-yl)phenyl]-1H-imidazole-2-carboxamide |
| SMILES | CN1CC(c2ccc(NC(=O)c3ncc(C#N)[nH]3)c(C3=CCC(C)(C)CC3)c2)CN(C)C1=NC#N |
| InChI | InChI=1S/C26H30N8O/c1-26(2)9-7-17(8-10-26)21-11-18(19-14-33(3)25(30-16-28)34(4)15-19)5-6-22(21)32-24(35)23-29-13-20(12-27)31-23/h5-7,11,13,19H,8-10,14-15H2,1-4H3,(H,29,31)(H,32,35)/b30-25- |
| InChIKey | LTYFCBHZCORHHY-JVCXMKTPSA-N |
| XLogP | 3.93 |
| TPSA | 124.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|