About (2-benzamido-2-oxoethyl) 1,3-benzothiazole-6-carboxylate
(2-benzamido-2-oxoethyl) 1,3-benzothiazole-6-carboxylate (PubChem CID 2478326) has the molecular formula C17H12N2O4S
and a molecular weight of 340.36 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) 1,3-benzothiazole-6-carboxylate.
Molecular Properties
| Compound Name | (2-benzamido-2-oxoethyl) 1,3-benzothiazole-6-carboxylate |
| PubChem CID | 2478326 |
| Molecular Formula | C17H12N2O4S |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | (2-benzamido-2-oxoethyl) 1,3-benzothiazole-6-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2ncsc2c1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H12N2O4S/c20-15(19-16(21)11-4-2-1-3-5-11)9-23-17(22)12-6-7-13-14(8-12)24-10-18-13/h1-8,10H,9H2,(H,19,20,21) |
| InChIKey | NAJUTMBTWCQNPO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2-benzamido-2-oxoethyl) 1,3-benzothiazole-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-benzamido-2-oxoethyl) 1,3-benzothiazole-6-carboxylate?
The IUPAC name of (2-benzamido-2-oxoethyl) 1,3-benzothiazole-6-carboxylate (CID 2478326) is (2-benzamido-2-oxoethyl) 1,3-benzothiazole-6-carboxylate.
What is the SMILES notation for (2-benzamido-2-oxoethyl) 1,3-benzothiazole-6-carboxylate?
The canonical SMILES for (2-benzamido-2-oxoethyl) 1,3-benzothiazole-6-carboxylate is O=C(COC(=O)c1ccc2ncsc2c1)NC(=O)c1ccccc1.
What is the InChIKey of (2-benzamido-2-oxoethyl) 1,3-benzothiazole-6-carboxylate?
The InChIKey is NAJUTMBTWCQNPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N2O4S/c20-15(19-16(21)11-4-2-1-3-5-11)9-23-17(22)12-6-7-13-14(8-12)24-10-18-13/h1-8,10H,9H2,(H,19,20,21).
What are the key properties of (2-benzamido-2-oxoethyl) 1,3-benzothiazole-6-carboxylate?
(2-benzamido-2-oxoethyl) 1,3-benzothiazole-6-carboxylate has a molecular weight of 340.36 g/mol, XLogP of 2.41, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-benzamido-2-oxoethyl) 1,3-benzothiazole-6-carboxylate is sourced from PubChem (CID 2478326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).