C22H28CsFN3O6S — CID 24783646
CID 24783646 (PubChem CID 24783646) has the molecular formula C22H28CsFN3O6S and a molecular weight of 614.45 g/mol.
| Compound Name | CID 24783646 |
|---|---|
| PubChem CID | 24783646 |
| Molecular Formula | C22H28CsFN3O6S |
| Molecular Weight | 614.45 g/mol |
| Exact Mass | 614.07 |
| IUPAC Name | — |
| SMILES | CC(C)c1nc(N(C)S(C)(=O)=O)nc(-c2ccc(F)cc2)c1/C=C/[C@@H](O)C[C@@H](O)CC(=O)O.[Cs] |
| InChI | InChI=1S/C22H28FN3O6S.Cs/c1-13(2)20-18(10-9-16(27)11-17(28)12-19(29)30)21(14-5-7-15(23)8-6-14)25-22(24-20)26(3)33(4,31)32;/h5-10,13,16-17,27-28H,11-12H2,1-4H3,(H,29,30);/b10-9+;/t16-,17-;/m1./s1 |
| InChIKey | JNEYJOYOZXFRSK-DHMAKVBVSA-N |
| XLogP | 2.02 |
| TPSA | 140.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |