C21H22N4O3 — CID 24784274
5-methoxy-10-(2-morpholin-4-ylethylamino)-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-8-one (PubChem CID 24784274) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is 5-methoxy-10-(2-morpholin-4-ylethylamino)-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-8-one.
| Compound Name | 5-methoxy-10-(2-morpholin-4-ylethylamino)-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-8-one |
|---|---|
| PubChem CID | 24784274 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 5-methoxy-10-(2-morpholin-4-ylethylamino)-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-8-one |
| SMILES | COc1ccc2c(c1)c(=O)c1c(NCCN3CCOCC3)ccc3ncn2c31 |
| InChI | InChI=1S/C21H22N4O3/c1-27-14-2-5-18-15(12-14)21(26)19-16(3-4-17-20(19)25(18)13-23-17)22-6-7-24-8-10-28-11-9-24/h2-5,12-13,22H,6-11H2,1H3 |
| InChIKey | XZCICPOJBIUXJB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|