C21H26N6O3 — CID 24784354
(2R)-2-amino-1-[4-[(5R)-5-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]piperazin-1-yl]-3-(4-nitrophenyl)propan-1-one (PubChem CID 24784354) has the molecular formula C21H26N6O3 and a molecular weight of 410.48 g/mol. Its IUPAC name is (2R)-2-amino-1-[4-[(5R)-5-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]piperazin-1-yl]-3-(4-nitrophenyl)propan-1-one.
| Compound Name | (2R)-2-amino-1-[4-[(5R)-5-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]piperazin-1-yl]-3-(4-nitrophenyl)propan-1-one |
|---|---|
| PubChem CID | 24784354 |
| Molecular Formula | C21H26N6O3 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | (2R)-2-amino-1-[4-[(5R)-5-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]piperazin-1-yl]-3-(4-nitrophenyl)propan-1-one |
| SMILES | C[C@@H]1CCc2ncnc(N3CCN(C(=O)[C@H](N)Cc4ccc([N+](=O)[O-])cc4)CC3)c21 |
| InChI | InChI=1S/C21H26N6O3/c1-14-2-7-18-19(14)20(24-13-23-18)25-8-10-26(11-9-25)21(28)17(22)12-15-3-5-16(6-4-15)27(29)30/h3-6,13-14,17H,2,7-12,22H2,1H3/t14-,17-/m1/s1 |
| InChIKey | DDGIVYMDOHEKCF-RHSMWYFYSA-N |
| XLogP | 1.65 |
| TPSA | 118.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|