About tert-butyl [(1S,5R)-5-methyl-4-oxocyclohex-2-en-1-yl] carbonate
tert-butyl [(1S,5R)-5-methyl-4-oxocyclohex-2-en-1-yl] carbonate (PubChem CID 24784698) has the molecular formula C12H18O4
and a molecular weight of 226.27 g/mol. Its IUPAC name is tert-butyl [(1S,5R)-5-methyl-4-oxocyclohex-2-en-1-yl] carbonate.
Molecular Properties
| Compound Name | tert-butyl [(1S,5R)-5-methyl-4-oxocyclohex-2-en-1-yl] carbonate |
| PubChem CID | 24784698 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | tert-butyl [(1S,5R)-5-methyl-4-oxocyclohex-2-en-1-yl] carbonate |
| SMILES | C[C@@H]1C[C@H](OC(=O)OC(C)(C)C)C=CC1=O |
| InChI | InChI=1S/C12H18O4/c1-8-7-9(5-6-10(8)13)15-11(14)16-12(2,3)4/h5-6,8-9H,7H2,1-4H3/t8-,9-/m1/s1 |
| InChIKey | MMTBFLZGWBWEEH-RKDXNWHRSA-N |
| XLogP | 2.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl [(1S,5R)-5-methyl-4-oxocyclohex-2-en-1-yl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl [(1S,5R)-5-methyl-4-oxocyclohex-2-en-1-yl] carbonate?
The IUPAC name of tert-butyl [(1S,5R)-5-methyl-4-oxocyclohex-2-en-1-yl] carbonate (CID 24784698) is tert-butyl [(1S,5R)-5-methyl-4-oxocyclohex-2-en-1-yl] carbonate.
What is the SMILES notation for tert-butyl [(1S,5R)-5-methyl-4-oxocyclohex-2-en-1-yl] carbonate?
The canonical SMILES for tert-butyl [(1S,5R)-5-methyl-4-oxocyclohex-2-en-1-yl] carbonate is C[C@@H]1C[C@H](OC(=O)OC(C)(C)C)C=CC1=O.
What is the InChIKey of tert-butyl [(1S,5R)-5-methyl-4-oxocyclohex-2-en-1-yl] carbonate?
The InChIKey is MMTBFLZGWBWEEH-RKDXNWHRSA-N. The full InChI is InChI=1S/C12H18O4/c1-8-7-9(5-6-10(8)13)15-11(14)16-12(2,3)4/h5-6,8-9H,7H2,1-4H3/t8-,9-/m1/s1.
What are the key properties of tert-butyl [(1S,5R)-5-methyl-4-oxocyclohex-2-en-1-yl] carbonate?
tert-butyl [(1S,5R)-5-methyl-4-oxocyclohex-2-en-1-yl] carbonate has a molecular weight of 226.27 g/mol, XLogP of 2.47, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl [(1S,5R)-5-methyl-4-oxocyclohex-2-en-1-yl] carbonate is sourced from PubChem (CID 24784698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).