C17H14Cl2N2O4 — CID 24784811
1-[3,5-dichloro-4-(3-ethyl-4-hydroxyphenoxy)phenyl]imidazolidine-2,4-dione (PubChem CID 24784811) has the molecular formula C17H14Cl2N2O4 and a molecular weight of 381.22 g/mol. Its IUPAC name is 1-[3,5-dichloro-4-(3-ethyl-4-hydroxyphenoxy)phenyl]imidazolidine-2,4-dione.
| Compound Name | 1-[3,5-dichloro-4-(3-ethyl-4-hydroxyphenoxy)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 24784811 |
| Molecular Formula | C17H14Cl2N2O4 |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | 1-[3,5-dichloro-4-(3-ethyl-4-hydroxyphenoxy)phenyl]imidazolidine-2,4-dione |
| SMILES | CCc1cc(Oc2c(Cl)cc(N3CC(=O)NC3=O)cc2Cl)ccc1O |
| InChI | InChI=1S/C17H14Cl2N2O4/c1-2-9-5-11(3-4-14(9)22)25-16-12(18)6-10(7-13(16)19)21-8-15(23)20-17(21)24/h3-7,22H,2,8H2,1H3,(H,20,23,24) |
| InChIKey | OYVADWOGJBDJRO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|