C21H21Cl2N3O6S — CID 24785046
N-cyclohexyl-5-[2,6-dichloro-4-(2,4-dioxoimidazolidin-1-yl)phenoxy]-2-hydroxybenzenesulfonamide (PubChem CID 24785046) has the molecular formula C21H21Cl2N3O6S and a molecular weight of 514.39 g/mol. Its IUPAC name is N-cyclohexyl-5-[2,6-dichloro-4-(2,4-dioxoimidazolidin-1-yl)phenoxy]-2-hydroxybenzenesulfonamide.
| Compound Name | N-cyclohexyl-5-[2,6-dichloro-4-(2,4-dioxoimidazolidin-1-yl)phenoxy]-2-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 24785046 |
| Molecular Formula | C21H21Cl2N3O6S |
| Molecular Weight | 514.39 g/mol |
| Exact Mass | 513.05 |
| IUPAC Name | N-cyclohexyl-5-[2,6-dichloro-4-(2,4-dioxoimidazolidin-1-yl)phenoxy]-2-hydroxybenzenesulfonamide |
| SMILES | O=C1CN(c2cc(Cl)c(Oc3ccc(O)c(S(=O)(=O)NC4CCCCC4)c3)c(Cl)c2)C(=O)N1 |
| InChI | InChI=1S/C21H21Cl2N3O6S/c22-15-8-13(26-11-19(28)24-21(26)29)9-16(23)20(15)32-14-6-7-17(27)18(10-14)33(30,31)25-12-4-2-1-3-5-12/h6-10,12,25,27H,1-5,11H2,(H,24,28,29) |
| InChIKey | DOEVXTWAOKTDLF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|