C35H42F6N6O5 — CID 24785309
[(2R)-3-[4-amino-3,5-bis(trifluoromethyl)phenyl]-1-[4-(4-methyl-1,4-diazepan-1-yl)piperidin-1-yl]-1-oxopropan-2-yl] 2-oxospiro[1H-3,1-benzoxazine-4,4'-piperidine]-1'-carboxylate (PubChem CID 24785309) has the molecular formula C35H42F6N6O5 and a molecular weight of 740.75 g/mol. Its IUPAC name is [(2R)-3-[4-amino-3,5-bis(trifluoromethyl)phenyl]-1-[4-(4-methyl-1,4-diazepan-1-yl)piperidin-1-yl]-1-oxopropan-2-yl] 2-oxospiro[1H-3,1-benzoxazine-4,4'-piperidine]-1'-carboxylate.
| Compound Name | [(2R)-3-[4-amino-3,5-bis(trifluoromethyl)phenyl]-1-[4-(4-methyl-1,4-diazepan-1-yl)piperidin-1-yl]-1-oxopropan-2-yl] 2-oxospiro[1H-3,1-benzoxazine-4,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 24785309 |
| Molecular Formula | C35H42F6N6O5 |
| Molecular Weight | 740.75 g/mol |
| Exact Mass | 740.31 |
| IUPAC Name | [(2R)-3-[4-amino-3,5-bis(trifluoromethyl)phenyl]-1-[4-(4-methyl-1,4-diazepan-1-yl)piperidin-1-yl]-1-oxopropan-2-yl] 2-oxospiro[1H-3,1-benzoxazine-4,4'-piperidine]-1'-carboxylate |
| SMILES | CN1CCCN(C2CCN(C(=O)[C@@H](Cc3cc(C(F)(F)F)c(N)c(C(F)(F)F)c3)OC(=O)N3CCC4(CC3)OC(=O)Nc3ccccc34)CC2)CC1 |
| InChI | InChI=1S/C35H42F6N6O5/c1-44-11-4-12-45(18-17-44)23-7-13-46(14-8-23)30(48)28(21-22-19-25(34(36,37)38)29(42)26(20-22)35(39,40)41)51-32(50)47-15-9-33(10-16-47)24-5-2-3-6-27(24)43-31(49)52-33/h2-3,5-6,19-20,23,28H,4,7-18,21,42H2,1H3,(H,43,49)/t28-/m1/s1 |
| InChIKey | GFIJYRSFQWSLAI-MUUNZHRXSA-N |
| XLogP | 5.54 |
| TPSA | 120.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.75 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|