C23H26FN5O4 — CID 24785333
2-fluoro-N-[3-methoxy-4-[5-(3-morpholin-4-ylpropylamino)-1,3,4-oxadiazol-2-yl]phenyl]benzamide (PubChem CID 24785333) has the molecular formula C23H26FN5O4 and a molecular weight of 455.49 g/mol. Its IUPAC name is 2-fluoro-N-[3-methoxy-4-[5-(3-morpholin-4-ylpropylamino)-1,3,4-oxadiazol-2-yl]phenyl]benzamide.
| Compound Name | 2-fluoro-N-[3-methoxy-4-[5-(3-morpholin-4-ylpropylamino)-1,3,4-oxadiazol-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 24785333 |
| Molecular Formula | C23H26FN5O4 |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 2-fluoro-N-[3-methoxy-4-[5-(3-morpholin-4-ylpropylamino)-1,3,4-oxadiazol-2-yl]phenyl]benzamide |
| SMILES | COc1cc(NC(=O)c2ccccc2F)ccc1-c1nnc(NCCCN2CCOCC2)o1 |
| InChI | InChI=1S/C23H26FN5O4/c1-31-20-15-16(26-21(30)17-5-2-3-6-19(17)24)7-8-18(20)22-27-28-23(33-22)25-9-4-10-29-11-13-32-14-12-29/h2-3,5-8,15H,4,9-14H2,1H3,(H,25,28)(H,26,30) |
| InChIKey | KEFVASIGMVPSQU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 101.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|