About 1-[3,5-dichloro-4-(4-hydroxy-3-phenylphenoxy)phenyl]imidazolidine-2,4-dione
1-[3,5-dichloro-4-(4-hydroxy-3-phenylphenoxy)phenyl]imidazolidine-2,4-dione (PubChem CID 24785559) has the molecular formula C21H14Cl2N2O4
and a molecular weight of 429.26 g/mol. Its IUPAC name is 1-[3,5-dichloro-4-(4-hydroxy-3-phenylphenoxy)phenyl]imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 1-[3,5-dichloro-4-(4-hydroxy-3-phenylphenoxy)phenyl]imidazolidine-2,4-dione |
| PubChem CID | 24785559 |
| Molecular Formula | C21H14Cl2N2O4 |
| Molecular Weight | 429.26 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | 1-[3,5-dichloro-4-(4-hydroxy-3-phenylphenoxy)phenyl]imidazolidine-2,4-dione |
| SMILES | O=C1CN(c2cc(Cl)c(Oc3ccc(O)c(-c4ccccc4)c3)c(Cl)c2)C(=O)N1 |
| InChI | InChI=1S/C21H14Cl2N2O4/c22-16-8-13(25-11-19(27)24-21(25)28)9-17(23)20(16)29-14-6-7-18(26)15(10-14)12-4-2-1-3-5-12/h1-10,26H,11H2,(H,24,27,28) |
| InChIKey | TTYBLOCNIURCEL-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.26 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 1-[3,5-dichloro-4-(4-hydroxy-3-phenylphenoxy)phenyl]imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,5-dichloro-4-(4-hydroxy-3-phenylphenoxy)phenyl]imidazolidine-2,4-dione?
The IUPAC name of 1-[3,5-dichloro-4-(4-hydroxy-3-phenylphenoxy)phenyl]imidazolidine-2,4-dione (CID 24785559) is 1-[3,5-dichloro-4-(4-hydroxy-3-phenylphenoxy)phenyl]imidazolidine-2,4-dione.
What is the SMILES notation for 1-[3,5-dichloro-4-(4-hydroxy-3-phenylphenoxy)phenyl]imidazolidine-2,4-dione?
The canonical SMILES for 1-[3,5-dichloro-4-(4-hydroxy-3-phenylphenoxy)phenyl]imidazolidine-2,4-dione is O=C1CN(c2cc(Cl)c(Oc3ccc(O)c(-c4ccccc4)c3)c(Cl)c2)C(=O)N1.
What is the InChIKey of 1-[3,5-dichloro-4-(4-hydroxy-3-phenylphenoxy)phenyl]imidazolidine-2,4-dione?
The InChIKey is TTYBLOCNIURCEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14Cl2N2O4/c22-16-8-13(25-11-19(27)24-21(25)28)9-17(23)20(16)29-14-6-7-18(26)15(10-14)12-4-2-1-3-5-12/h1-10,26H,11H2,(H,24,27,28).
What are the key properties of 1-[3,5-dichloro-4-(4-hydroxy-3-phenylphenoxy)phenyl]imidazolidine-2,4-dione?
1-[3,5-dichloro-4-(4-hydroxy-3-phenylphenoxy)phenyl]imidazolidine-2,4-dione has a molecular weight of 429.26 g/mol, XLogP of 5.21, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,5-dichloro-4-(4-hydroxy-3-phenylphenoxy)phenyl]imidazolidine-2,4-dione is sourced from PubChem (CID 24785559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).