C19H17F3O2S — CID 24785670
1-methyl-4-(1,6,6-trifluoro-5-phenylcyclohex-3-en-1-yl)sulfonylbenzene (PubChem CID 24785670) has the molecular formula C19H17F3O2S and a molecular weight of 366.40 g/mol. Its IUPAC name is 1-methyl-4-(1,6,6-trifluoro-5-phenylcyclohex-3-en-1-yl)sulfonylbenzene.
| Compound Name | 1-methyl-4-(1,6,6-trifluoro-5-phenylcyclohex-3-en-1-yl)sulfonylbenzene |
|---|---|
| PubChem CID | 24785670 |
| Molecular Formula | C19H17F3O2S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 1-methyl-4-(1,6,6-trifluoro-5-phenylcyclohex-3-en-1-yl)sulfonylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)C2(F)CC=CC(c3ccccc3)C2(F)F)cc1 |
| InChI | InChI=1S/C19H17F3O2S/c1-14-9-11-16(12-10-14)25(23,24)18(20)13-5-8-17(19(18,21)22)15-6-3-2-4-7-15/h2-12,17H,13H2,1H3 |
| InChIKey | SPLLAMRRWXFTSG-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|