C26H27F3N2O — CID 24785718
4-[3-[(1-methyl-4-phenylpiperidin-4-yl)methoxymethyl]-5-(trifluoromethyl)phenyl]pyridine (PubChem CID 24785718) has the molecular formula C26H27F3N2O and a molecular weight of 440.51 g/mol. Its IUPAC name is 4-[3-[(1-methyl-4-phenylpiperidin-4-yl)methoxymethyl]-5-(trifluoromethyl)phenyl]pyridine.
| Compound Name | 4-[3-[(1-methyl-4-phenylpiperidin-4-yl)methoxymethyl]-5-(trifluoromethyl)phenyl]pyridine |
|---|---|
| PubChem CID | 24785718 |
| Molecular Formula | C26H27F3N2O |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 4-[3-[(1-methyl-4-phenylpiperidin-4-yl)methoxymethyl]-5-(trifluoromethyl)phenyl]pyridine |
| SMILES | CN1CCC(COCc2cc(-c3ccncc3)cc(C(F)(F)F)c2)(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H27F3N2O/c1-31-13-9-25(10-14-31,23-5-3-2-4-6-23)19-32-18-20-15-22(21-7-11-30-12-8-21)17-24(16-20)26(27,28)29/h2-8,11-12,15-17H,9-10,13-14,18-19H2,1H3 |
| InChIKey | KZVFCWCKYJZYKP-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |