C20H20Cl2N2O4 — CID 24785831
1-[4-(3-tert-butyl-4-methoxyphenoxy)-3,5-dichlorophenyl]imidazolidine-2,4-dione (PubChem CID 24785831) has the molecular formula C20H20Cl2N2O4 and a molecular weight of 423.30 g/mol. Its IUPAC name is 1-[4-(3-tert-butyl-4-methoxyphenoxy)-3,5-dichlorophenyl]imidazolidine-2,4-dione.
| Compound Name | 1-[4-(3-tert-butyl-4-methoxyphenoxy)-3,5-dichlorophenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 24785831 |
| Molecular Formula | C20H20Cl2N2O4 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 1-[4-(3-tert-butyl-4-methoxyphenoxy)-3,5-dichlorophenyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc(Oc2c(Cl)cc(N3CC(=O)NC3=O)cc2Cl)cc1C(C)(C)C |
| InChI | InChI=1S/C20H20Cl2N2O4/c1-20(2,3)13-9-12(5-6-16(13)27-4)28-18-14(21)7-11(8-15(18)22)24-10-17(25)23-19(24)26/h5-9H,10H2,1-4H3,(H,23,25,26) |
| InChIKey | KSIUYUMECGQVMI-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|