C11H8Cl3N3O2 — CID 24786352
6-methyl-1-(2,4,5-trichloroanilino)pyrimidine-2,4-dione (PubChem CID 24786352) has the molecular formula C11H8Cl3N3O2 and a molecular weight of 320.56 g/mol. Its IUPAC name is 6-methyl-1-(2,4,5-trichloroanilino)pyrimidine-2,4-dione.
| Compound Name | 6-methyl-1-(2,4,5-trichloroanilino)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 24786352 |
| Molecular Formula | C11H8Cl3N3O2 |
| Molecular Weight | 320.56 g/mol |
| Exact Mass | 318.97 |
| IUPAC Name | 6-methyl-1-(2,4,5-trichloroanilino)pyrimidine-2,4-dione |
| SMILES | Cc1cc(=O)[nH]c(=O)n1Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H8Cl3N3O2/c1-5-2-10(18)15-11(19)17(5)16-9-4-7(13)6(12)3-8(9)14/h2-4,16H,1H3,(H,15,18,19) |
| InChIKey | NWDAXQIQJYQSAZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.56 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|