C21H34O3Si — CID 24786551
(3aR,5S,5aS,9aR)-7-[tert-butyl(dimethyl)silyl]oxy-5,8-dimethyl-1-methylidene-3a,4,5,5a,6,7,9,9a-octahydroazuleno[6,5-b]furan-2-one (PubChem CID 24786551) has the molecular formula C21H34O3Si and a molecular weight of 362.59 g/mol. Its IUPAC name is (3aR,5S,5aS,9aR)-7-[tert-butyl(dimethyl)silyl]oxy-5,8-dimethyl-1-methylidene-3a,4,5,5a,6,7,9,9a-octahydroazuleno[6,5-b]furan-2-one.
| Compound Name | (3aR,5S,5aS,9aR)-7-[tert-butyl(dimethyl)silyl]oxy-5,8-dimethyl-1-methylidene-3a,4,5,5a,6,7,9,9a-octahydroazuleno[6,5-b]furan-2-one |
|---|---|
| PubChem CID | 24786551 |
| Molecular Formula | C21H34O3Si |
| Molecular Weight | 362.59 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | (3aR,5S,5aS,9aR)-7-[tert-butyl(dimethyl)silyl]oxy-5,8-dimethyl-1-methylidene-3a,4,5,5a,6,7,9,9a-octahydroazuleno[6,5-b]furan-2-one |
| SMILES | C=C1C(=O)O[C@@H]2C[C@H](C)[C@@H]3CC(O[Si](C)(C)C(C)(C)C)C(C)=C3C[C@H]12 |
| InChI | InChI=1S/C21H34O3Si/c1-12-9-19-17(14(3)20(22)23-19)10-16-13(2)18(11-15(12)16)24-25(7,8)21(4,5)6/h12,15,17-19H,3,9-11H2,1-2,4-8H3/t12-,15-,17+,18?,19+/m0/s1 |
| InChIKey | FLDUMTNKRGKAOB-PZCBKPRESA-N |
| XLogP | 5.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.59 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|