C20H34O3Si — CID 24786592
(3aR,5S,5aS,9aR)-7-[tert-butyl(dimethyl)silyl]oxy-5,8-dimethyl-3a,4,5,5a,6,7,9,9a-octahydro-1H-azuleno[6,5-b]furan-2-one (PubChem CID 24786592) has the molecular formula C20H34O3Si and a molecular weight of 350.58 g/mol. Its IUPAC name is (3aR,5S,5aS,9aR)-7-[tert-butyl(dimethyl)silyl]oxy-5,8-dimethyl-3a,4,5,5a,6,7,9,9a-octahydro-1H-azuleno[6,5-b]furan-2-one.
| Compound Name | (3aR,5S,5aS,9aR)-7-[tert-butyl(dimethyl)silyl]oxy-5,8-dimethyl-3a,4,5,5a,6,7,9,9a-octahydro-1H-azuleno[6,5-b]furan-2-one |
|---|---|
| PubChem CID | 24786592 |
| Molecular Formula | C20H34O3Si |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | (3aR,5S,5aS,9aR)-7-[tert-butyl(dimethyl)silyl]oxy-5,8-dimethyl-3a,4,5,5a,6,7,9,9a-octahydro-1H-azuleno[6,5-b]furan-2-one |
| SMILES | CC1=C2C[C@@H]3CC(=O)O[C@@H]3C[C@H](C)[C@@H]2CC1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H34O3Si/c1-12-8-18-14(10-19(21)22-18)9-16-13(2)17(11-15(12)16)23-24(6,7)20(3,4)5/h12,14-15,17-18H,8-11H2,1-7H3/t12-,14+,15-,17?,18+/m0/s1 |
| InChIKey | CFITWDYSQYNWMY-MDLYAHKQSA-N |
| XLogP | 5.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|