C18H30O5S — CID 24786598
[(2R,3S,6R)-3-acetyloxy-6-octylsulfanyl-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 24786598) has the molecular formula C18H30O5S and a molecular weight of 358.50 g/mol. Its IUPAC name is [(2R,3S,6R)-3-acetyloxy-6-octylsulfanyl-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S,6R)-3-acetyloxy-6-octylsulfanyl-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 24786598 |
| Molecular Formula | C18H30O5S |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | [(2R,3S,6R)-3-acetyloxy-6-octylsulfanyl-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CCCCCCCCS[C@@H]1C=C[C@H](OC(C)=O)[C@@H](COC(C)=O)O1 |
| InChI | InChI=1S/C18H30O5S/c1-4-5-6-7-8-9-12-24-18-11-10-16(22-15(3)20)17(23-18)13-21-14(2)19/h10-11,16-18H,4-9,12-13H2,1-3H3/t16-,17+,18+/m0/s1 |
| InChIKey | ZARXDIWNMWLTMO-RCCFBDPRSA-N |
| XLogP | 3.86 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|