About 3-[(Z)-2-butyltellanylethenyl]-2,5-diphenylselenophene
3-[(Z)-2-butyltellanylethenyl]-2,5-diphenylselenophene (PubChem CID 24786620) has the molecular formula C22H22SeTe
and a molecular weight of 492.98 g/mol. Its IUPAC name is 3-[(Z)-2-butyltellanylethenyl]-2,5-diphenylselenophene.
Molecular Properties
| Compound Name | 3-[(Z)-2-butyltellanylethenyl]-2,5-diphenylselenophene |
| PubChem CID | 24786620 |
| Molecular Formula | C22H22SeTe |
| Molecular Weight | 492.98 g/mol |
| Exact Mass | 495.99 |
| IUPAC Name | 3-[(Z)-2-butyltellanylethenyl]-2,5-diphenylselenophene |
| SMILES | CCCC[Te]/C=C\c1cc(-c2ccccc2)[se]c1-c1ccccc1 |
| InChI | InChI=1S/C22H22SeTe/c1-2-3-15-24-16-14-20-17-21(18-10-6-4-7-11-18)23-22(20)19-12-8-5-9-13-19/h4-14,16-17H,2-3,15H2,1H3/b16-14- |
| InChIKey | NDDMZBODGJMKAS-PEZBUJJGSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.98 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-[(Z)-2-butyltellanylethenyl]-2,5-diphenylselenophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(Z)-2-butyltellanylethenyl]-2,5-diphenylselenophene?
The IUPAC name of 3-[(Z)-2-butyltellanylethenyl]-2,5-diphenylselenophene (CID 24786620) is 3-[(Z)-2-butyltellanylethenyl]-2,5-diphenylselenophene.
What is the SMILES notation for 3-[(Z)-2-butyltellanylethenyl]-2,5-diphenylselenophene?
The canonical SMILES for 3-[(Z)-2-butyltellanylethenyl]-2,5-diphenylselenophene is CCCC[Te]/C=C\c1cc(-c2ccccc2)[se]c1-c1ccccc1.
What is the InChIKey of 3-[(Z)-2-butyltellanylethenyl]-2,5-diphenylselenophene?
The InChIKey is NDDMZBODGJMKAS-PEZBUJJGSA-N. The full InChI is InChI=1S/C22H22SeTe/c1-2-3-15-24-16-14-20-17-21(18-10-6-4-7-11-18)23-22(20)19-12-8-5-9-13-19/h4-14,16-17H,2-3,15H2,1H3/b16-14-.
What are the key properties of 3-[(Z)-2-butyltellanylethenyl]-2,5-diphenylselenophene?
3-[(Z)-2-butyltellanylethenyl]-2,5-diphenylselenophene has a molecular weight of 492.98 g/mol, XLogP of 5.97, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(Z)-2-butyltellanylethenyl]-2,5-diphenylselenophene is sourced from PubChem (CID 24786620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).