C21H38O2Si2 — CID 24786810
[(1S,4aR,7R,8aS)-1,4a-dimethyl-7-prop-1-en-2-yl-5-trimethylsilyloxy-4,7,8,8a-tetrahydro-1H-naphthalen-2-yl]oxy-trimethylsilane (PubChem CID 24786810) has the molecular formula C21H38O2Si2 and a molecular weight of 378.71 g/mol. Its IUPAC name is [(1S,4aR,7R,8aS)-1,4a-dimethyl-7-prop-1-en-2-yl-5-trimethylsilyloxy-4,7,8,8a-tetrahydro-1H-naphthalen-2-yl]oxy-trimethylsilane.
| Compound Name | [(1S,4aR,7R,8aS)-1,4a-dimethyl-7-prop-1-en-2-yl-5-trimethylsilyloxy-4,7,8,8a-tetrahydro-1H-naphthalen-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 24786810 |
| Molecular Formula | C21H38O2Si2 |
| Molecular Weight | 378.71 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | [(1S,4aR,7R,8aS)-1,4a-dimethyl-7-prop-1-en-2-yl-5-trimethylsilyloxy-4,7,8,8a-tetrahydro-1H-naphthalen-2-yl]oxy-trimethylsilane |
| SMILES | C=C(C)[C@H]1C=C(O[Si](C)(C)C)[C@]2(C)CC=C(O[Si](C)(C)C)[C@@H](C)[C@@H]2C1 |
| InChI | InChI=1S/C21H38O2Si2/c1-15(2)17-13-18-16(3)19(22-24(5,6)7)11-12-21(18,4)20(14-17)23-25(8,9)10/h11,14,16-18H,1,12-13H2,2-10H3/t16-,17+,18-,21+/m0/s1 |
| InChIKey | NUGNOXFFYMKDJT-TWFHAPMSSA-N |
| XLogP | 6.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.71 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|