C20H34O3 — CID 24786863
(2S,5R,6R)-6-[2-(1,3-dioxolan-2-yl)ethyl]-5-methyl-2-[(2S)-5-methylhex-5-en-2-yl]cycloheptan-1-one (PubChem CID 24786863) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is (2S,5R,6R)-6-[2-(1,3-dioxolan-2-yl)ethyl]-5-methyl-2-[(2S)-5-methylhex-5-en-2-yl]cycloheptan-1-one.
| Compound Name | (2S,5R,6R)-6-[2-(1,3-dioxolan-2-yl)ethyl]-5-methyl-2-[(2S)-5-methylhex-5-en-2-yl]cycloheptan-1-one |
|---|---|
| PubChem CID | 24786863 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | (2S,5R,6R)-6-[2-(1,3-dioxolan-2-yl)ethyl]-5-methyl-2-[(2S)-5-methylhex-5-en-2-yl]cycloheptan-1-one |
| SMILES | C=C(C)CC[C@H](C)[C@@H]1CC[C@@H](C)[C@H](CCC2OCCO2)CC1=O |
| InChI | InChI=1S/C20H34O3/c1-14(2)5-6-16(4)18-9-7-15(3)17(13-19(18)21)8-10-20-22-11-12-23-20/h15-18,20H,1,5-13H2,2-4H3/t15-,16+,17-,18+/m1/s1 |
| InChIKey | GNVTUWKJQHOXCC-XDNAFOTISA-N |
| XLogP | 4.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|