C49H52O2P2 — CID 24787587
[(9R,11R)-17-bis(3,5-dimethylphenyl)phosphanyl-9,11-dimethyl-8,12-dioxatricyclo[11.4.0.02,7]heptadeca-1(13),2(7),3,5,14,16-hexaen-3-yl]-bis(3,5-dimethylphenyl)phosphane (PubChem CID 24787587) has the molecular formula C49H52O2P2 and a molecular weight of 734.90 g/mol. Its IUPAC name is [(9R,11R)-17-bis(3,5-dimethylphenyl)phosphanyl-9,11-dimethyl-8,12-dioxatricyclo[11.4.0.02,7]heptadeca-1(13),2(7),3,5,14,16-hexaen-3-yl]-bis(3,5-dimethylphenyl)phosphane.
| Compound Name | [(9R,11R)-17-bis(3,5-dimethylphenyl)phosphanyl-9,11-dimethyl-8,12-dioxatricyclo[11.4.0.02,7]heptadeca-1(13),2(7),3,5,14,16-hexaen-3-yl]-bis(3,5-dimethylphenyl)phosphane |
|---|---|
| PubChem CID | 24787587 |
| Molecular Formula | C49H52O2P2 |
| Molecular Weight | 734.90 g/mol |
| Exact Mass | 734.34 |
| IUPAC Name | [(9R,11R)-17-bis(3,5-dimethylphenyl)phosphanyl-9,11-dimethyl-8,12-dioxatricyclo[11.4.0.02,7]heptadeca-1(13),2(7),3,5,14,16-hexaen-3-yl]-bis(3,5-dimethylphenyl)phosphane |
| SMILES | Cc1cc(C)cc(P(c2cc(C)cc(C)c2)c2cccc3c2-c2c(cccc2P(c2cc(C)cc(C)c2)c2cc(C)cc(C)c2)O[C@H](C)C[C@@H](C)O3)c1 |
| InChI | InChI=1S/C49H52O2P2/c1-30-17-31(2)22-40(21-30)52(41-23-32(3)18-33(4)24-41)46-15-11-13-44-48(46)49-45(51-39(10)29-38(9)50-44)14-12-16-47(49)53(42-25-34(5)19-35(6)26-42)43-27-36(7)20-37(8)28-43/h11-28,38-39H,29H2,1-10H3/t38-,39-/m1/s1 |
| InChIKey | AYODEEOODFMMOD-LJEWAXOPSA-N |
| XLogP | 10.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.90 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|