C35H70O5Si3 — CID 24787960
(1R,2R,4S,5Z,7R)-2-methyl-2,4-bis(triethylsilyloxy)-5-[(2S)-1-tri(propan-2-yl)silyloxypropan-2-yl]-11-oxabicyclo[5.3.1]undec-5-en-8-one (PubChem CID 24787960) has the molecular formula C35H70O5Si3 and a molecular weight of 655.20 g/mol. Its IUPAC name is (1R,2R,4S,5Z,7R)-2-methyl-2,4-bis(triethylsilyloxy)-5-[(2S)-1-tri(propan-2-yl)silyloxypropan-2-yl]-11-oxabicyclo[5.3.1]undec-5-en-8-one.
| Compound Name | (1R,2R,4S,5Z,7R)-2-methyl-2,4-bis(triethylsilyloxy)-5-[(2S)-1-tri(propan-2-yl)silyloxypropan-2-yl]-11-oxabicyclo[5.3.1]undec-5-en-8-one |
|---|---|
| PubChem CID | 24787960 |
| Molecular Formula | C35H70O5Si3 |
| Molecular Weight | 655.20 g/mol |
| Exact Mass | 654.45 |
| IUPAC Name | (1R,2R,4S,5Z,7R)-2-methyl-2,4-bis(triethylsilyloxy)-5-[(2S)-1-tri(propan-2-yl)silyloxypropan-2-yl]-11-oxabicyclo[5.3.1]undec-5-en-8-one |
| SMILES | CC[Si](CC)(CC)O[C@H]1C[C@@](C)(O[Si](CC)(CC)CC)[C@H]2CCC(=O)[C@@H](/C=C\1[C@H](C)CO[Si](C(C)C)(C(C)C)C(C)C)O2 |
| InChI | InChI=1S/C35H70O5Si3/c1-15-41(16-2,17-3)39-33-24-35(14,40-42(18-4,19-5)20-6)34-22-21-31(36)32(38-34)23-30(33)29(13)25-37-43(26(7)8,27(9)10)28(11)12/h23,26-29,32-34H,15-22,24-25H2,1-14H3/b30-23-/t29-,32-,33+,34-,35-/m1/s1 |
| InChIKey | WZCWEAXMUXADAP-HCEVDKFASA-N |
| XLogP | 10.43 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.20 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|