C25H18Cl2F2N2O3 — CID 24788252
(3R,4'S,6'S)-6-chloro-4'-(3-chlorophenyl)-6'-(2,3-difluoro-6-methoxyphenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione (PubChem CID 24788252) has the molecular formula C25H18Cl2F2N2O3 and a molecular weight of 503.33 g/mol. Its IUPAC name is (3R,4'S,6'S)-6-chloro-4'-(3-chlorophenyl)-6'-(2,3-difluoro-6-methoxyphenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione.
| Compound Name | (3R,4'S,6'S)-6-chloro-4'-(3-chlorophenyl)-6'-(2,3-difluoro-6-methoxyphenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
|---|---|
| PubChem CID | 24788252 |
| Molecular Formula | C25H18Cl2F2N2O3 |
| Molecular Weight | 503.33 g/mol |
| Exact Mass | 502.07 |
| IUPAC Name | (3R,4'S,6'S)-6-chloro-4'-(3-chlorophenyl)-6'-(2,3-difluoro-6-methoxyphenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
| SMILES | COc1ccc(F)c(F)c1[C@H]1NC(=O)C[C@@H](c2cccc(Cl)c2)[C@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C25H18Cl2F2N2O3/c1-34-19-8-7-17(28)22(29)21(19)23-25(15-6-5-14(27)10-18(15)30-24(25)33)16(11-20(32)31-23)12-3-2-4-13(26)9-12/h2-10,16,23H,11H2,1H3,(H,30,33)(H,31,32)/t16-,23+,25-/m0/s1 |
| InChIKey | BLVOCSLIELAUCB-VVHBXYOFSA-N |
| XLogP | 5.52 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.33 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |