About N-(2-nitrophenyl)-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-2-imine
N-(2-nitrophenyl)-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-2-imine (PubChem CID 24788351) has the molecular formula C15H14N4O2S
and a molecular weight of 314.37 g/mol. Its IUPAC name is N-(2-nitrophenyl)-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-2-imine.
Molecular Properties
| Compound Name | N-(2-nitrophenyl)-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-2-imine |
| PubChem CID | 24788351 |
| Molecular Formula | C15H14N4O2S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | N-(2-nitrophenyl)-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-2-imine |
| SMILES | O=[N+]([O-])c1ccccc1/N=C1\SCCN1Cc1cccnc1 |
| InChI | InChI=1S/C15H14N4O2S/c20-19(21)14-6-2-1-5-13(14)17-15-18(8-9-22-15)11-12-4-3-7-16-10-12/h1-7,10H,8-9,11H2/b17-15- |
| InChIKey | OAWCNNUJOQVQLM-ICFOKQHNSA-N |
| XLogP | 3.23 |
| TPSA | 71.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-nitrophenyl)-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-nitrophenyl)-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-2-imine?
The IUPAC name of N-(2-nitrophenyl)-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-2-imine (CID 24788351) is N-(2-nitrophenyl)-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-2-imine.
What is the SMILES notation for N-(2-nitrophenyl)-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-2-imine?
The canonical SMILES for N-(2-nitrophenyl)-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-2-imine is O=[N+]([O-])c1ccccc1/N=C1\SCCN1Cc1cccnc1.
What is the InChIKey of N-(2-nitrophenyl)-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-2-imine?
The InChIKey is OAWCNNUJOQVQLM-ICFOKQHNSA-N. The full InChI is InChI=1S/C15H14N4O2S/c20-19(21)14-6-2-1-5-13(14)17-15-18(8-9-22-15)11-12-4-3-7-16-10-12/h1-7,10H,8-9,11H2/b17-15-.
What are the key properties of N-(2-nitrophenyl)-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-2-imine?
N-(2-nitrophenyl)-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-2-imine has a molecular weight of 314.37 g/mol, XLogP of 3.23, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-nitrophenyl)-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-2-imine is sourced from PubChem (CID 24788351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).