C15H10Cl2N2O — CID 24788421
7,9-dichloro-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one (PubChem CID 24788421) has the molecular formula C15H10Cl2N2O and a molecular weight of 305.16 g/mol. Its IUPAC name is 7,9-dichloro-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one.
| Compound Name | 7,9-dichloro-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 24788421 |
| Molecular Formula | C15H10Cl2N2O |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 7,9-dichloro-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
| SMILES | O=C1CN=C(c2ccccc2)c2cc(Cl)cc(Cl)c2N1 |
| InChI | InChI=1S/C15H10Cl2N2O/c16-10-6-11-14(9-4-2-1-3-5-9)18-8-13(20)19-15(11)12(17)7-10/h1-7H,8H2,(H,19,20) |
| InChIKey | LODQZIQLZDHYJG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |