C21H17ClN4O5 — CID 24788439
1-(4-chlorophenyl)-3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]methyl]urea (PubChem CID 24788439) has the molecular formula C21H17ClN4O5 and a molecular weight of 440.84 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]methyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]methyl]urea |
|---|---|
| PubChem CID | 24788439 |
| Molecular Formula | C21H17ClN4O5 |
| Molecular Weight | 440.84 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]methyl]urea |
| SMILES | O=C1CCC(N2C(=O)c3ccc(CNC(=O)Nc4ccc(Cl)cc4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H17ClN4O5/c22-12-2-4-13(5-3-12)24-21(31)23-10-11-1-6-14-15(9-11)20(30)26(19(14)29)16-7-8-17(27)25-18(16)28/h1-6,9,16H,7-8,10H2,(H2,23,24,31)(H,25,27,28) |
| InChIKey | GACAOIKPNDQHIU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.84 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|